C10H13N3OS — CID 55208431
2-cyano-N-[(4-methyl-1,3-thiazol-2-yl)methyl]butanamide (PubChem CID 55208431) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is 2-cyano-N-[(4-methyl-1,3-thiazol-2-yl)methyl]butanamide.
| Compound Name | 2-cyano-N-[(4-methyl-1,3-thiazol-2-yl)methyl]butanamide |
|---|---|
| PubChem CID | 55208431 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2-cyano-N-[(4-methyl-1,3-thiazol-2-yl)methyl]butanamide |
| SMILES | CCC(C#N)C(=O)NCc1nc(C)cs1 |
| InChI | InChI=1S/C10H13N3OS/c1-3-8(4-11)10(14)12-5-9-13-7(2)6-15-9/h6,8H,3,5H2,1-2H3,(H,12,14) |
| InChIKey | AYCXQTHXAZQVIZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |