C14H14N2OS — CID 115188332
N-(1-benzothiophen-3-ylmethyl)-2-cyanobutanamide (PubChem CID 115188332) has the molecular formula C14H14N2OS and a molecular weight of 258.35 g/mol. Its IUPAC name is N-(1-benzothiophen-3-ylmethyl)-2-cyanobutanamide.
| Compound Name | N-(1-benzothiophen-3-ylmethyl)-2-cyanobutanamide |
|---|---|
| PubChem CID | 115188332 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | N-(1-benzothiophen-3-ylmethyl)-2-cyanobutanamide |
| SMILES | CCC(C#N)C(=O)NCc1csc2ccccc12 |
| InChI | InChI=1S/C14H14N2OS/c1-2-10(7-15)14(17)16-8-11-9-18-13-6-4-3-5-12(11)13/h3-6,9-10H,2,8H2,1H3,(H,16,17) |
| InChIKey | BBMYAJBJEUXHEL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |