C17H19N3O2S — CID 110351108
N-[[4-(2-oxo-1,3-dihydroindol-5-yl)-1,3-thiazol-2-yl]methyl]pentanamide (PubChem CID 110351108) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is N-[[4-(2-oxo-1,3-dihydroindol-5-yl)-1,3-thiazol-2-yl]methyl]pentanamide.
| Compound Name | N-[[4-(2-oxo-1,3-dihydroindol-5-yl)-1,3-thiazol-2-yl]methyl]pentanamide |
|---|---|
| PubChem CID | 110351108 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-[[4-(2-oxo-1,3-dihydroindol-5-yl)-1,3-thiazol-2-yl]methyl]pentanamide |
| SMILES | CCCCC(=O)NCc1nc(-c2ccc3c(c2)CC(=O)N3)cs1 |
| InChI | InChI=1S/C17H19N3O2S/c1-2-3-4-15(21)18-9-17-20-14(10-23-17)11-5-6-13-12(7-11)8-16(22)19-13/h5-7,10H,2-4,8-9H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | NULWSANIJPWMCS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |