C17H12N2O2S — CID 135570014
5-[2-(4-hydroxyphenyl)-1,3-thiazol-4-yl]-1,3-dihydroindol-2-one (PubChem CID 135570014) has the molecular formula C17H12N2O2S and a molecular weight of 308.36 g/mol. Its IUPAC name is 5-[2-(4-hydroxyphenyl)-1,3-thiazol-4-yl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[2-(4-hydroxyphenyl)-1,3-thiazol-4-yl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 135570014 |
| Molecular Formula | C17H12N2O2S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 5-[2-(4-hydroxyphenyl)-1,3-thiazol-4-yl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(-c3csc(-c4ccc(O)cc4)n3)ccc2N1 |
| InChI | InChI=1S/C17H12N2O2S/c20-13-4-1-10(2-5-13)17-19-15(9-22-17)11-3-6-14-12(7-11)8-16(21)18-14/h1-7,9,20H,8H2,(H,18,21) |
| InChIKey | JPFLGPFNVPUOFR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |