C14H11NO2 — CID 68878128
6-(4-hydroxyphenyl)-1,3-dihydroindol-2-one (PubChem CID 68878128) has the molecular formula C14H11NO2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 6-(4-hydroxyphenyl)-1,3-dihydroindol-2-one.
| Compound Name | 6-(4-hydroxyphenyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 68878128 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 6-(4-hydroxyphenyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2ccc(-c3ccc(O)cc3)cc2N1 |
| InChI | InChI=1S/C14H11NO2/c16-12-5-3-9(4-6-12)10-1-2-11-8-14(17)15-13(11)7-10/h1-7,16H,8H2,(H,15,17) |
| InChIKey | DWJHNWPUGWSCAP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |