C14H10ClNO2 — CID 121317048
6-chloro-5-(4-hydroxyphenyl)-1,3-dihydroindol-2-one (PubChem CID 121317048) has the molecular formula C14H10ClNO2 and a molecular weight of 259.69 g/mol. Its IUPAC name is 6-chloro-5-(4-hydroxyphenyl)-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-(4-hydroxyphenyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 121317048 |
| Molecular Formula | C14H10ClNO2 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 6-chloro-5-(4-hydroxyphenyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(-c3ccc(O)cc3)c(Cl)cc2N1 |
| InChI | InChI=1S/C14H10ClNO2/c15-12-7-13-9(6-14(18)16-13)5-11(12)8-1-3-10(17)4-2-8/h1-5,7,17H,6H2,(H,16,18) |
| InChIKey | IIPUBGAMXIVACA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |