C15H10ClNO3 — CID 146216092
4-chloro-3-(2-oxo-1,3-dihydroindol-5-yl)benzoic acid (PubChem CID 146216092) has the molecular formula C15H10ClNO3 and a molecular weight of 287.70 g/mol. Its IUPAC name is 4-chloro-3-(2-oxo-1,3-dihydroindol-5-yl)benzoic acid.
| Compound Name | 4-chloro-3-(2-oxo-1,3-dihydroindol-5-yl)benzoic acid |
|---|---|
| PubChem CID | 146216092 |
| Molecular Formula | C15H10ClNO3 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 4-chloro-3-(2-oxo-1,3-dihydroindol-5-yl)benzoic acid |
| SMILES | O=C1Cc2cc(-c3cc(C(=O)O)ccc3Cl)ccc2N1 |
| InChI | InChI=1S/C15H10ClNO3/c16-12-3-1-9(15(19)20)6-11(12)8-2-4-13-10(5-8)7-14(18)17-13/h1-6H,7H2,(H,17,18)(H,19,20) |
| InChIKey | HCYBKCHWSAQKRX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |