4-(2-oxo-1,3-dihydroindol-5-yl)pyrimidine-5-carboxylic acid

C13H9N3O3 — CID 82482166

IUPAC4-(2-oxo-1,3-dihydroindol-5-yl)pyrimidine-5-carboxylic acid
SMILESO=C1Cc2cc(-c3ncncc3C(=O)O)ccc2N1
InChIInChI=1S/C13H9N3O3/c17-11-4-8-3-7(1-2-10(8)16-11)12-9(13(18)19)5-14-6-15-12/h1-3,5-6H,4H2,(H,16,17)(H,18,19)
InChIKeyXWARJPDMYKJOCV-UHFFFAOYSA-N
MW255.23 g/mol
LogP1.34
Rot. Bonds2

About 4-(2-oxo-1,3-dihydroindol-5-yl)pyrimidine-5-carboxylic acid

4-(2-oxo-1,3-dihydroindol-5-yl)pyrimidine-5-carboxylic acid (PubChem CID 82482166) has the molecular formula C13H9N3O3 and a molecular weight of 255.23 g/mol. Its IUPAC name is 4-(2-oxo-1,3-dihydroindol-5-yl)pyrimidine-5-carboxylic acid.

Molecular Properties

Compound Name4-(2-oxo-1,3-dihydroindol-5-yl)pyrimidine-5-carboxylic acid
PubChem CID82482166
Molecular FormulaC13H9N3O3
Molecular Weight255.23 g/mol
Exact Mass255.06
IUPAC Name4-(2-oxo-1,3-dihydroindol-5-yl)pyrimidine-5-carboxylic acid
SMILESO=C1Cc2cc(-c3ncncc3C(=O)O)ccc2N1
InChIInChI=1S/C13H9N3O3/c17-11-4-8-3-7(1-2-10(8)16-11)12-9(13(18)19)5-14-6-15-12/h1-3,5-6H,4H2,(H,16,17)(H,18,19)
InChIKeyXWARJPDMYKJOCV-UHFFFAOYSA-N
XLogP1.34
TPSA92.18 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.23
LogP ≤ 51.34
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-(2-oxo-1,3-dihydroindol-5-yl)pyrimidine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-oxo-1,3-dihydroindol-5-yl)pyrimidine-5-carboxylic acid?
The IUPAC name of 4-(2-oxo-1,3-dihydroindol-5-yl)pyrimidine-5-carboxylic acid (CID 82482166) is 4-(2-oxo-1,3-dihydroindol-5-yl)pyrimidine-5-carboxylic acid.
What is the SMILES notation for 4-(2-oxo-1,3-dihydroindol-5-yl)pyrimidine-5-carboxylic acid?
The canonical SMILES for 4-(2-oxo-1,3-dihydroindol-5-yl)pyrimidine-5-carboxylic acid is O=C1Cc2cc(-c3ncncc3C(=O)O)ccc2N1.
What is the InChIKey of 4-(2-oxo-1,3-dihydroindol-5-yl)pyrimidine-5-carboxylic acid?
The InChIKey is XWARJPDMYKJOCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O3/c17-11-4-8-3-7(1-2-10(8)16-11)12-9(13(18)19)5-14-6-15-12/h1-3,5-6H,4H2,(H,16,17)(H,18,19).
What are the key properties of 4-(2-oxo-1,3-dihydroindol-5-yl)pyrimidine-5-carboxylic acid?
4-(2-oxo-1,3-dihydroindol-5-yl)pyrimidine-5-carboxylic acid has a molecular weight of 255.23 g/mol, XLogP of 1.34, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-oxo-1,3-dihydroindol-5-yl)pyrimidine-5-carboxylic acid is sourced from PubChem (CID 82482166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).