C14H11N3O2 — CID 175778528
3-(2-oxo-1,3-dihydroindol-5-yl)pyridine-4-carboxamide (PubChem CID 175778528) has the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 3-(2-oxo-1,3-dihydroindol-5-yl)pyridine-4-carboxamide.
| Compound Name | 3-(2-oxo-1,3-dihydroindol-5-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 175778528 |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 3-(2-oxo-1,3-dihydroindol-5-yl)pyridine-4-carboxamide |
| SMILES | NC(=O)c1ccncc1-c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C14H11N3O2/c15-14(19)10-3-4-16-7-11(10)8-1-2-12-9(5-8)6-13(18)17-12/h1-5,7H,6H2,(H2,15,19)(H,17,18) |
| InChIKey | PFPGBDUHAUFLCA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |