C17H13N3OS — CID 90041635
5-[5-(5-amino-3-pyridinyl)thiophen-2-yl]-1,3-dihydroindol-2-one (PubChem CID 90041635) has the molecular formula C17H13N3OS and a molecular weight of 307.38 g/mol. Its IUPAC name is 5-[5-(5-amino-3-pyridinyl)thiophen-2-yl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[5-(5-amino-3-pyridinyl)thiophen-2-yl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 90041635 |
| Molecular Formula | C17H13N3OS |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 5-[5-(5-amino-3-pyridinyl)thiophen-2-yl]-1,3-dihydroindol-2-one |
| SMILES | Nc1cncc(-c2ccc(-c3ccc4c(c3)CC(=O)N4)s2)c1 |
| InChI | InChI=1S/C17H13N3OS/c18-13-6-12(8-19-9-13)16-4-3-15(22-16)10-1-2-14-11(5-10)7-17(21)20-14/h1-6,8-9H,7,18H2,(H,20,21) |
| InChIKey | PRXMYIVHVPYZCN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |