C14H8Cl3NO — CID 147482882
5-(2,4,6-trichlorophenyl)-1,3-dihydroindol-2-one (PubChem CID 147482882) has the molecular formula C14H8Cl3NO and a molecular weight of 312.58 g/mol. Its IUPAC name is 5-(2,4,6-trichlorophenyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-(2,4,6-trichlorophenyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 147482882 |
| Molecular Formula | C14H8Cl3NO |
| Molecular Weight | 312.58 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | 5-(2,4,6-trichlorophenyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(-c3c(Cl)cc(Cl)cc3Cl)ccc2N1 |
| InChI | InChI=1S/C14H8Cl3NO/c15-9-5-10(16)14(11(17)6-9)7-1-2-12-8(3-7)4-13(19)18-12/h1-3,5-6H,4H2,(H,18,19) |
| InChIKey | FDZUKOOADNMWGS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |