C17H17NO — CID 122662664
5-(2-ethyl-6-methylphenyl)-1,3-dihydroindol-2-one (PubChem CID 122662664) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 5-(2-ethyl-6-methylphenyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-(2-ethyl-6-methylphenyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 122662664 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 5-(2-ethyl-6-methylphenyl)-1,3-dihydroindol-2-one |
| SMILES | CCc1cccc(C)c1-c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C17H17NO/c1-3-12-6-4-5-11(2)17(12)13-7-8-15-14(9-13)10-16(19)18-15/h4-9H,3,10H2,1-2H3,(H,18,19) |
| InChIKey | DXEYLJQGGSZUMA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |