C15H13NOS — CID 146227564
5-(2-methyl-5-sulfanylphenyl)-1,3-dihydroindol-2-one (PubChem CID 146227564) has the molecular formula C15H13NOS and a molecular weight of 255.34 g/mol. Its IUPAC name is 5-(2-methyl-5-sulfanylphenyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-(2-methyl-5-sulfanylphenyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 146227564 |
| Molecular Formula | C15H13NOS |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 5-(2-methyl-5-sulfanylphenyl)-1,3-dihydroindol-2-one |
| SMILES | Cc1ccc(S)cc1-c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C15H13NOS/c1-9-2-4-12(18)8-13(9)10-3-5-14-11(6-10)7-15(17)16-14/h2-6,8,18H,7H2,1H3,(H,16,17) |
| InChIKey | QUYNEAHHAIRHJX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|