C16H14ClNO — CID 144760752
6-chloro-5-(3,4-dimethylphenyl)-1,3-dihydroindol-2-one (PubChem CID 144760752) has the molecular formula C16H14ClNO and a molecular weight of 271.75 g/mol. Its IUPAC name is 6-chloro-5-(3,4-dimethylphenyl)-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-(3,4-dimethylphenyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 144760752 |
| Molecular Formula | C16H14ClNO |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 6-chloro-5-(3,4-dimethylphenyl)-1,3-dihydroindol-2-one |
| SMILES | Cc1ccc(-c2cc3c(cc2Cl)NC(=O)C3)cc1C |
| InChI | InChI=1S/C16H14ClNO/c1-9-3-4-11(5-10(9)2)13-6-12-7-16(19)18-15(12)8-14(13)17/h3-6,8H,7H2,1-2H3,(H,18,19) |
| InChIKey | ZKYRFDOKNAKHBM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |