C25H29ClN2O — CID 11661471
3-[4-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-3-ethyl-1H-indol-2-one (PubChem CID 11661471) has the molecular formula C25H29ClN2O and a molecular weight of 408.97 g/mol. Its IUPAC name is 3-[4-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-3-ethyl-1H-indol-2-one.
| Compound Name | 3-[4-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-3-ethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 11661471 |
| Molecular Formula | C25H29ClN2O |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 3-[4-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]-3-ethyl-1H-indol-2-one |
| SMILES | CCC1(CCCCN2CC=C(c3ccc(Cl)cc3)CC2)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C25H29ClN2O/c1-2-25(22-7-3-4-8-23(22)27-24(25)29)15-5-6-16-28-17-13-20(14-18-28)19-9-11-21(26)12-10-19/h3-4,7-13H,2,5-6,14-18H2,1H3,(H,27,29) |
| InChIKey | BEVYRGDFSYRITQ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|