C24H29ClFN3O — CID 24854041
3-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-3-ethyl-6-fluoro-1H-indol-2-one (PubChem CID 24854041) has the molecular formula C24H29ClFN3O and a molecular weight of 429.97 g/mol. Its IUPAC name is 3-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-3-ethyl-6-fluoro-1H-indol-2-one.
| Compound Name | 3-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-3-ethyl-6-fluoro-1H-indol-2-one |
|---|---|
| PubChem CID | 24854041 |
| Molecular Formula | C24H29ClFN3O |
| Molecular Weight | 429.97 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 3-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-3-ethyl-6-fluoro-1H-indol-2-one |
| SMILES | CCC1(CCCCN2CCN(c3cccc(Cl)c3)CC2)C(=O)Nc2cc(F)ccc21 |
| InChI | InChI=1S/C24H29ClFN3O/c1-2-24(21-9-8-19(26)17-22(21)27-23(24)30)10-3-4-11-28-12-14-29(15-13-28)20-7-5-6-18(25)16-20/h5-9,16-17H,2-4,10-15H2,1H3,(H,27,30) |
| InChIKey | ZZHRSCMSVPSESL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.97 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|