C20H22N2O — CID 162045284
5-[2-methyl-3-(pyrrolidin-1-ylmethyl)phenyl]-1,3-dihydroindol-2-one (PubChem CID 162045284) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is 5-[2-methyl-3-(pyrrolidin-1-ylmethyl)phenyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[2-methyl-3-(pyrrolidin-1-ylmethyl)phenyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 162045284 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 5-[2-methyl-3-(pyrrolidin-1-ylmethyl)phenyl]-1,3-dihydroindol-2-one |
| SMILES | Cc1c(CN2CCCC2)cccc1-c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C20H22N2O/c1-14-16(13-22-9-2-3-10-22)5-4-6-18(14)15-7-8-19-17(11-15)12-20(23)21-19/h4-8,11H,2-3,9-10,12-13H2,1H3,(H,21,23) |
| InChIKey | YXUNMRNRGPENDO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |