C12H14N2O — CID 23363883
5-pyrrolidin-1-yl-1,3-dihydroindol-2-one (PubChem CID 23363883) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 5-pyrrolidin-1-yl-1,3-dihydroindol-2-one.
| Compound Name | 5-pyrrolidin-1-yl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 23363883 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 5-pyrrolidin-1-yl-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(N3CCCC3)ccc2N1 |
| InChI | InChI=1S/C12H14N2O/c15-12-8-9-7-10(3-4-11(9)13-12)14-5-1-2-6-14/h3-4,7H,1-2,5-6,8H2,(H,13,15) |
| InChIKey | OSNDRSCPINUHAR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|