C20H22N4O4S — CID 44825291
N-[4-(4-acetylpiperazin-1-yl)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide (PubChem CID 44825291) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is N-[4-(4-acetylpiperazin-1-yl)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide.
| Compound Name | N-[4-(4-acetylpiperazin-1-yl)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 44825291 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | N-[4-(4-acetylpiperazin-1-yl)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide |
| SMILES | CC(=O)N1CCN(c2ccc(NS(=O)(=O)c3ccc4c(c3)CC(=O)N4)cc2)CC1 |
| InChI | InChI=1S/C20H22N4O4S/c1-14(25)23-8-10-24(11-9-23)17-4-2-16(3-5-17)22-29(27,28)18-6-7-19-15(12-18)13-20(26)21-19/h2-7,12,22H,8-11,13H2,1H3,(H,21,26) |
| InChIKey | NWQCXJCLHVAEPH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|