C19H21N3O4S — CID 110637346
N-[4-(2-methylmorpholin-4-yl)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide (PubChem CID 110637346) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is N-[4-(2-methylmorpholin-4-yl)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide.
| Compound Name | N-[4-(2-methylmorpholin-4-yl)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 110637346 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-[4-(2-methylmorpholin-4-yl)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide |
| SMILES | CC1CN(c2ccc(NS(=O)(=O)c3ccc4c(c3)CC(=O)N4)cc2)CCO1 |
| InChI | InChI=1S/C19H21N3O4S/c1-13-12-22(8-9-26-13)16-4-2-15(3-5-16)21-27(24,25)17-6-7-18-14(10-17)11-19(23)20-18/h2-7,10,13,21H,8-9,11-12H2,1H3,(H,20,23) |
| InChIKey | MCTNMWJBUMQFNQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|