C15H19N3O4S — CID 110715026
N-(1-acetylpiperidin-4-yl)-2-oxo-1,3-dihydroindole-5-sulfonamide (PubChem CID 110715026) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is N-(1-acetylpiperidin-4-yl)-2-oxo-1,3-dihydroindole-5-sulfonamide.
| Compound Name | N-(1-acetylpiperidin-4-yl)-2-oxo-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 110715026 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-(1-acetylpiperidin-4-yl)-2-oxo-1,3-dihydroindole-5-sulfonamide |
| SMILES | CC(=O)N1CCC(NS(=O)(=O)c2ccc3c(c2)CC(=O)N3)CC1 |
| InChI | InChI=1S/C15H19N3O4S/c1-10(19)18-6-4-12(5-7-18)17-23(21,22)13-2-3-14-11(8-13)9-15(20)16-14/h2-3,8,12,17H,4-7,9H2,1H3,(H,16,20) |
| InChIKey | QBMLFZQTBWJBMU-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |