C10H11N3O5S — CID 112673502
2-[(2-oxo-1,3-dihydroindol-5-yl)sulfonylamino]oxyacetamide (PubChem CID 112673502) has the molecular formula C10H11N3O5S and a molecular weight of 285.28 g/mol. Its IUPAC name is 2-[(2-oxo-1,3-dihydroindol-5-yl)sulfonylamino]oxyacetamide.
| Compound Name | 2-[(2-oxo-1,3-dihydroindol-5-yl)sulfonylamino]oxyacetamide |
|---|---|
| PubChem CID | 112673502 |
| Molecular Formula | C10H11N3O5S |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 2-[(2-oxo-1,3-dihydroindol-5-yl)sulfonylamino]oxyacetamide |
| SMILES | NC(=O)CONS(=O)(=O)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C10H11N3O5S/c11-9(14)5-18-13-19(16,17)7-1-2-8-6(3-7)4-10(15)12-8/h1-3,13H,4-5H2,(H2,11,14)(H,12,15) |
| InChIKey | AMVFYFJXPKRFOJ-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|