C11H13N3O5S — CID 115992115
2-[(1-methyl-2-oxo-3H-indol-5-yl)sulfonylamino]oxyacetamide (PubChem CID 115992115) has the molecular formula C11H13N3O5S and a molecular weight of 299.31 g/mol. Its IUPAC name is 2-[(1-methyl-2-oxo-3H-indol-5-yl)sulfonylamino]oxyacetamide.
| Compound Name | 2-[(1-methyl-2-oxo-3H-indol-5-yl)sulfonylamino]oxyacetamide |
|---|---|
| PubChem CID | 115992115 |
| Molecular Formula | C11H13N3O5S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2-[(1-methyl-2-oxo-3H-indol-5-yl)sulfonylamino]oxyacetamide |
| SMILES | CN1C(=O)Cc2cc(S(=O)(=O)NOCC(N)=O)ccc21 |
| InChI | InChI=1S/C11H13N3O5S/c1-14-9-3-2-8(4-7(9)5-11(14)16)20(17,18)13-19-6-10(12)15/h2-4,13H,5-6H2,1H3,(H2,12,15) |
| InChIKey | GFNTZZHLPGITRQ-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|