C20H20N2O6S — CID 8954805
[2-(1-methyl-2-oxo-3H-indol-5-yl)-2-oxoethyl] 4-(ethylsulfamoyl)benzoate (PubChem CID 8954805) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is [2-(1-methyl-2-oxo-3H-indol-5-yl)-2-oxoethyl] 4-(ethylsulfamoyl)benzoate.
| Compound Name | [2-(1-methyl-2-oxo-3H-indol-5-yl)-2-oxoethyl] 4-(ethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8954805 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | [2-(1-methyl-2-oxo-3H-indol-5-yl)-2-oxoethyl] 4-(ethylsulfamoyl)benzoate |
| SMILES | CCNS(=O)(=O)c1ccc(C(=O)OCC(=O)c2ccc3c(c2)CC(=O)N3C)cc1 |
| InChI | InChI=1S/C20H20N2O6S/c1-3-21-29(26,27)16-7-4-13(5-8-16)20(25)28-12-18(23)14-6-9-17-15(10-14)11-19(24)22(17)2/h4-10,21H,3,11-12H2,1-2H3 |
| InChIKey | WAEBUQVOZGWVDN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |