C14H19N3O5S — CID 112991190
N-(2-methoxyethyl)-2-[(1-methyl-2-oxo-3H-indol-5-yl)sulfonylamino]acetamide (PubChem CID 112991190) has the molecular formula C14H19N3O5S and a molecular weight of 341.39 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[(1-methyl-2-oxo-3H-indol-5-yl)sulfonylamino]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[(1-methyl-2-oxo-3H-indol-5-yl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 112991190 |
| Molecular Formula | C14H19N3O5S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-(2-methoxyethyl)-2-[(1-methyl-2-oxo-3H-indol-5-yl)sulfonylamino]acetamide |
| SMILES | COCCNC(=O)CNS(=O)(=O)c1ccc2c(c1)CC(=O)N2C |
| InChI | InChI=1S/C14H19N3O5S/c1-17-12-4-3-11(7-10(12)8-14(17)19)23(20,21)16-9-13(18)15-5-6-22-2/h3-4,7,16H,5-6,8-9H2,1-2H3,(H,15,18) |
| InChIKey | NLCRRICIDUYGTF-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|