C14H17N3O4S — CID 110867530
(2S)-1-[(1-methyl-2-oxo-3H-indol-5-yl)sulfonyl]pyrrolidine-2-carboxamide (PubChem CID 110867530) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is (2S)-1-[(1-methyl-2-oxo-3H-indol-5-yl)sulfonyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(1-methyl-2-oxo-3H-indol-5-yl)sulfonyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110867530 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | (2S)-1-[(1-methyl-2-oxo-3H-indol-5-yl)sulfonyl]pyrrolidine-2-carboxamide |
| SMILES | CN1C(=O)Cc2cc(S(=O)(=O)N3CCC[C@H]3C(N)=O)ccc21 |
| InChI | InChI=1S/C14H17N3O4S/c1-16-11-5-4-10(7-9(11)8-13(16)18)22(20,21)17-6-2-3-12(17)14(15)19/h4-5,7,12H,2-3,6,8H2,1H3,(H2,15,19)/t12-/m0/s1 |
| InChIKey | HZZLPUWRCZYCBS-LBPRGKRZSA-N |
| XLogP | -0.16 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |