C15H19N3O5S — CID 110818534
methyl 4-[(1-methyl-2-oxo-3H-indol-5-yl)sulfonyl]piperazine-1-carboxylate (PubChem CID 110818534) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is methyl 4-[(1-methyl-2-oxo-3H-indol-5-yl)sulfonyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[(1-methyl-2-oxo-3H-indol-5-yl)sulfonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110818534 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | methyl 4-[(1-methyl-2-oxo-3H-indol-5-yl)sulfonyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(S(=O)(=O)c2ccc3c(c2)CC(=O)N3C)CC1 |
| InChI | InChI=1S/C15H19N3O5S/c1-16-13-4-3-12(9-11(13)10-14(16)19)24(21,22)18-7-5-17(6-8-18)15(20)23-2/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | JYBLMQYCSJGUBN-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |