C13H16N2O4S2 — CID 110721628
1-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]-3H-indol-2-one (PubChem CID 110721628) has the molecular formula C13H16N2O4S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 1-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]-3H-indol-2-one.
| Compound Name | 1-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]-3H-indol-2-one |
|---|---|
| PubChem CID | 110721628 |
| Molecular Formula | C13H16N2O4S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 1-methyl-5-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]-3H-indol-2-one |
| SMILES | CN1C(=O)Cc2cc(S(=O)(=O)N3CCS(=O)CC3)ccc21 |
| InChI | InChI=1S/C13H16N2O4S2/c1-14-12-3-2-11(8-10(12)9-13(14)16)21(18,19)15-4-6-20(17)7-5-15/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | FPZWBSGPZGOXLX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |