C10H13ClN2O3S2 — CID 113288420
2-chloro-4-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]aniline (PubChem CID 113288420) has the molecular formula C10H13ClN2O3S2 and a molecular weight of 308.81 g/mol. Its IUPAC name is 2-chloro-4-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]aniline.
| Compound Name | 2-chloro-4-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]aniline |
|---|---|
| PubChem CID | 113288420 |
| Molecular Formula | C10H13ClN2O3S2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 2-chloro-4-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]aniline |
| SMILES | Nc1ccc(S(=O)(=O)N2CCS(=O)CC2)cc1Cl |
| InChI | InChI=1S/C10H13ClN2O3S2/c11-9-7-8(1-2-10(9)12)18(15,16)13-3-5-17(14)6-4-13/h1-2,7H,3-6,12H2 |
| InChIKey | JCKUTFNJWIQXSH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|