C9H13N3O3S2 — CID 62159105
5-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]pyridin-2-amine (PubChem CID 62159105) has the molecular formula C9H13N3O3S2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 5-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]pyridin-2-amine.
| Compound Name | 5-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]pyridin-2-amine |
|---|---|
| PubChem CID | 62159105 |
| Molecular Formula | C9H13N3O3S2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 5-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]pyridin-2-amine |
| SMILES | Nc1ccc(S(=O)(=O)N2CCS(=O)CC2)cn1 |
| InChI | InChI=1S/C9H13N3O3S2/c10-9-2-1-8(7-11-9)17(14,15)12-3-5-16(13)6-4-12/h1-2,7H,3-6H2,(H2,10,11) |
| InChIKey | WFLRAQSFNDIFAG-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |