C8H10ClN3O3S2 — CID 54975901
4-(2-chloropyrimidin-5-yl)sulfonyl-1,4-thiazinane 1-oxide (PubChem CID 54975901) has the molecular formula C8H10ClN3O3S2 and a molecular weight of 295.77 g/mol. Its IUPAC name is 4-(2-chloropyrimidin-5-yl)sulfonyl-1,4-thiazinane 1-oxide.
| Compound Name | 4-(2-chloropyrimidin-5-yl)sulfonyl-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 54975901 |
| Molecular Formula | C8H10ClN3O3S2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | 4-(2-chloropyrimidin-5-yl)sulfonyl-1,4-thiazinane 1-oxide |
| SMILES | O=S1CCN(S(=O)(=O)c2cnc(Cl)nc2)CC1 |
| InChI | InChI=1S/C8H10ClN3O3S2/c9-8-10-5-7(6-11-8)17(14,15)12-1-3-16(13)4-2-12/h5-6H,1-4H2 |
| InChIKey | VWINAAOKICIOMN-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |