C9H10ClN3O2S — CID 114408721
2-chloro-5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)pyrimidine (PubChem CID 114408721) has the molecular formula C9H10ClN3O2S and a molecular weight of 259.72 g/mol. Its IUPAC name is 2-chloro-5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)pyrimidine.
| Compound Name | 2-chloro-5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)pyrimidine |
|---|---|
| PubChem CID | 114408721 |
| Molecular Formula | C9H10ClN3O2S |
| Molecular Weight | 259.72 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 2-chloro-5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)pyrimidine |
| SMILES | O=S(=O)(c1cnc(Cl)nc1)N1CC=CCC1 |
| InChI | InChI=1S/C9H10ClN3O2S/c10-9-11-6-8(7-12-9)16(14,15)13-4-2-1-3-5-13/h1-2,6-7H,3-5H2 |
| InChIKey | BWQNUAAEUAOLMN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.72 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|