C11H12ClNO2S — CID 141178417
1-(3-chlorophenyl)sulfonyl-3,6-dihydro-2H-pyridine (PubChem CID 141178417) has the molecular formula C11H12ClNO2S and a molecular weight of 257.74 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfonyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(3-chlorophenyl)sulfonyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 141178417 |
| Molecular Formula | C11H12ClNO2S |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 1-(3-chlorophenyl)sulfonyl-3,6-dihydro-2H-pyridine |
| SMILES | O=S(=O)(c1cccc(Cl)c1)N1CC=CCC1 |
| InChI | InChI=1S/C11H12ClNO2S/c12-10-5-4-6-11(9-10)16(14,15)13-7-2-1-3-8-13/h1-2,4-6,9H,3,7-8H2 |
| InChIKey | PODVJKGMUVVTCI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|