C13H17ClN2O2S — CID 114414018
1-[2-chloro-5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)phenyl]-N-methylmethanamine (PubChem CID 114414018) has the molecular formula C13H17ClN2O2S and a molecular weight of 300.81 g/mol. Its IUPAC name is 1-[2-chloro-5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)phenyl]-N-methylmethanamine.
| Compound Name | 1-[2-chloro-5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 114414018 |
| Molecular Formula | C13H17ClN2O2S |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 1-[2-chloro-5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)phenyl]-N-methylmethanamine |
| SMILES | CNCc1cc(S(=O)(=O)N2CC=CCC2)ccc1Cl |
| InChI | InChI=1S/C13H17ClN2O2S/c1-15-10-11-9-12(5-6-13(11)14)19(17,18)16-7-3-2-4-8-16/h2-3,5-6,9,15H,4,7-8,10H2,1H3 |
| InChIKey | SMTYXIATVUKXEY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|