C23H26Cl2N4O2S — CID 59648243
1-[(2,6-dichlorophenyl)methyl]-5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-N,N-diethylindazol-3-amine (PubChem CID 59648243) has the molecular formula C23H26Cl2N4O2S and a molecular weight of 493.46 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-N,N-diethylindazol-3-amine.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-N,N-diethylindazol-3-amine |
|---|---|
| PubChem CID | 59648243 |
| Molecular Formula | C23H26Cl2N4O2S |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-N,N-diethylindazol-3-amine |
| SMILES | CCN(CC)c1nn(Cc2c(Cl)cccc2Cl)c2ccc(S(=O)(=O)N3CC=CCC3)cc12 |
| InChI | InChI=1S/C23H26Cl2N4O2S/c1-3-27(4-2)23-18-15-17(32(30,31)28-13-6-5-7-14-28)11-12-22(18)29(26-23)16-19-20(24)9-8-10-21(19)25/h5-6,8-12,15H,3-4,7,13-14,16H2,1-2H3 |
| InChIKey | VDZMZCYAAGCUPL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|