C21H34N4O2S — CID 143227968
N-ethyl-N-methyl-5-(4-methylpiperidin-1-yl)sulfonyl-1-pentylindazol-3-amine (PubChem CID 143227968) has the molecular formula C21H34N4O2S and a molecular weight of 406.60 g/mol. Its IUPAC name is N-ethyl-N-methyl-5-(4-methylpiperidin-1-yl)sulfonyl-1-pentylindazol-3-amine.
| Compound Name | N-ethyl-N-methyl-5-(4-methylpiperidin-1-yl)sulfonyl-1-pentylindazol-3-amine |
|---|---|
| PubChem CID | 143227968 |
| Molecular Formula | C21H34N4O2S |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | N-ethyl-N-methyl-5-(4-methylpiperidin-1-yl)sulfonyl-1-pentylindazol-3-amine |
| SMILES | CCCCCn1nc(N(C)CC)c2cc(S(=O)(=O)N3CCC(C)CC3)ccc21 |
| InChI | InChI=1S/C21H34N4O2S/c1-5-7-8-13-25-20-10-9-18(16-19(20)21(22-25)23(4)6-2)28(26,27)24-14-11-17(3)12-15-24/h9-10,16-17H,5-8,11-15H2,1-4H3 |
| InChIKey | LTYIWCYXEVTPTL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|