C16H20N2O5S — CID 110677110
6-(azepan-1-ylsulfonyl)-1-ethyl-3,1-benzoxazine-2,4-dione (PubChem CID 110677110) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is 6-(azepan-1-ylsulfonyl)-1-ethyl-3,1-benzoxazine-2,4-dione.
| Compound Name | 6-(azepan-1-ylsulfonyl)-1-ethyl-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 110677110 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 6-(azepan-1-ylsulfonyl)-1-ethyl-3,1-benzoxazine-2,4-dione |
| SMILES | CCn1c(=O)oc(=O)c2cc(S(=O)(=O)N3CCCCCC3)ccc21 |
| InChI | InChI=1S/C16H20N2O5S/c1-2-18-14-8-7-12(11-13(14)15(19)23-16(18)20)24(21,22)17-9-5-3-4-6-10-17/h7-8,11H,2-6,9-10H2,1H3 |
| InChIKey | IZCRQZZHNSADBV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 89.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |