C18H18N2O5S — CID 110677116
N-(2,4-dimethylphenyl)-1-ethyl-2,4-dioxo-3,1-benzoxazine-6-sulfonamide (PubChem CID 110677116) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-1-ethyl-2,4-dioxo-3,1-benzoxazine-6-sulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)-1-ethyl-2,4-dioxo-3,1-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 110677116 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | N-(2,4-dimethylphenyl)-1-ethyl-2,4-dioxo-3,1-benzoxazine-6-sulfonamide |
| SMILES | CCn1c(=O)oc(=O)c2cc(S(=O)(=O)Nc3ccc(C)cc3C)ccc21 |
| InChI | InChI=1S/C18H18N2O5S/c1-4-20-16-8-6-13(10-14(16)17(21)25-18(20)22)26(23,24)19-15-7-5-11(2)9-12(15)3/h5-10,19H,4H2,1-3H3 |
| InChIKey | CNPHNVAWCYKLLO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |