C10H12N2O4S — CID 92648195
3-ethyl-N-methyl-2-oxo-1,3-benzoxazole-6-sulfonamide (PubChem CID 92648195) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is 3-ethyl-N-methyl-2-oxo-1,3-benzoxazole-6-sulfonamide.
| Compound Name | 3-ethyl-N-methyl-2-oxo-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 92648195 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 3-ethyl-N-methyl-2-oxo-1,3-benzoxazole-6-sulfonamide |
| SMILES | CCn1c(=O)oc2cc(S(=O)(=O)NC)ccc21 |
| InChI | InChI=1S/C10H12N2O4S/c1-3-12-8-5-4-7(17(14,15)11-2)6-9(8)16-10(12)13/h4-6,11H,3H2,1-2H3 |
| InChIKey | MFWJXOCLEPDLOF-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |