C9H10N2O4S — CID 63839677
3-ethyl-2-oxo-1,3-benzoxazole-6-sulfonamide (PubChem CID 63839677) has the molecular formula C9H10N2O4S and a molecular weight of 242.26 g/mol. Its IUPAC name is 3-ethyl-2-oxo-1,3-benzoxazole-6-sulfonamide.
| Compound Name | 3-ethyl-2-oxo-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 63839677 |
| Molecular Formula | C9H10N2O4S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 3-ethyl-2-oxo-1,3-benzoxazole-6-sulfonamide |
| SMILES | CCn1c(=O)oc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C9H10N2O4S/c1-2-11-7-4-3-6(16(10,13)14)5-8(7)15-9(11)12/h3-5H,2H2,1H3,(H2,10,13,14) |
| InChIKey | XEOLGYDUCRGPEO-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 95.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |