C13H18N2O4S — CID 92648198
N-[(2S)-butan-2-yl]-3-ethyl-2-oxo-1,3-benzoxazole-6-sulfonamide (PubChem CID 92648198) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-3-ethyl-2-oxo-1,3-benzoxazole-6-sulfonamide.
| Compound Name | N-[(2S)-butan-2-yl]-3-ethyl-2-oxo-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 92648198 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-[(2S)-butan-2-yl]-3-ethyl-2-oxo-1,3-benzoxazole-6-sulfonamide |
| SMILES | CC[C@H](C)NS(=O)(=O)c1ccc2c(c1)oc(=O)n2CC |
| InChI | InChI=1S/C13H18N2O4S/c1-4-9(3)14-20(17,18)10-6-7-11-12(8-10)19-13(16)15(11)5-2/h6-9,14H,4-5H2,1-3H3/t9-/m0/s1 |
| InChIKey | XYOJLPNXUFGNPR-VIFPVBQESA-N |
| XLogP | 1.69 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |