C21H25N3O4S — CID 16673757
N-(1-benzylpiperidin-4-yl)-3-ethyl-2-oxo-1,3-benzoxazole-6-sulfonamide (PubChem CID 16673757) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-3-ethyl-2-oxo-1,3-benzoxazole-6-sulfonamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-3-ethyl-2-oxo-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 16673757 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-3-ethyl-2-oxo-1,3-benzoxazole-6-sulfonamide |
| SMILES | CCn1c(=O)oc2cc(S(=O)(=O)NC3CCN(Cc4ccccc4)CC3)ccc21 |
| InChI | InChI=1S/C21H25N3O4S/c1-2-24-19-9-8-18(14-20(19)28-21(24)25)29(26,27)22-17-10-12-23(13-11-17)15-16-6-4-3-5-7-16/h3-9,14,17,22H,2,10-13,15H2,1H3 |
| InChIKey | FPCBKXTVQSMMBC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |