C26H31N3O3S — CID 50760062
N-(1-benzylpiperidin-4-yl)-3-cyclopentylidene-1-methyl-2-oxoindole-5-sulfonamide (PubChem CID 50760062) has the molecular formula C26H31N3O3S and a molecular weight of 465.62 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-3-cyclopentylidene-1-methyl-2-oxoindole-5-sulfonamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-3-cyclopentylidene-1-methyl-2-oxoindole-5-sulfonamide |
|---|---|
| PubChem CID | 50760062 |
| Molecular Formula | C26H31N3O3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-3-cyclopentylidene-1-methyl-2-oxoindole-5-sulfonamide |
| SMILES | CN1C(=O)C(=C2CCCC2)c2cc(S(=O)(=O)NC3CCN(Cc4ccccc4)CC3)ccc21 |
| InChI | InChI=1S/C26H31N3O3S/c1-28-24-12-11-22(17-23(24)25(26(28)30)20-9-5-6-10-20)33(31,32)27-21-13-15-29(16-14-21)18-19-7-3-2-4-8-19/h2-4,7-8,11-12,17,21,27H,5-6,9-10,13-16,18H2,1H3 |
| InChIKey | PTSYXXQCXREQAE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|