C21H28ClN3O3S — CID 42913093
N-[[4-[(1-benzylpiperidin-4-yl)sulfamoyl]phenyl]methyl]acetamide;hydrochloride (PubChem CID 42913093) has the molecular formula C21H28ClN3O3S and a molecular weight of 437.99 g/mol. Its IUPAC name is N-[[4-[(1-benzylpiperidin-4-yl)sulfamoyl]phenyl]methyl]acetamide;hydrochloride.
| Compound Name | N-[[4-[(1-benzylpiperidin-4-yl)sulfamoyl]phenyl]methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 42913093 |
| Molecular Formula | C21H28ClN3O3S |
| Molecular Weight | 437.99 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | N-[[4-[(1-benzylpiperidin-4-yl)sulfamoyl]phenyl]methyl]acetamide;hydrochloride |
| SMILES | CC(=O)NCc1ccc(S(=O)(=O)NC2CCN(Cc3ccccc3)CC2)cc1.Cl |
| InChI | InChI=1S/C21H27N3O3S.ClH/c1-17(25)22-15-18-7-9-21(10-8-18)28(26,27)23-20-11-13-24(14-12-20)16-19-5-3-2-4-6-19;/h2-10,20,23H,11-16H2,1H3,(H,22,25);1H |
| InChIKey | OLWWFDOCNQUNLC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.99 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |