C19H26ClN3O3S2 — CID 55355371
N-[[5-[(1-benzylpiperidin-4-yl)sulfamoyl]thiophen-2-yl]methyl]acetamide;hydrochloride (PubChem CID 55355371) has the molecular formula C19H26ClN3O3S2 and a molecular weight of 444.02 g/mol. Its IUPAC name is N-[[5-[(1-benzylpiperidin-4-yl)sulfamoyl]thiophen-2-yl]methyl]acetamide;hydrochloride.
| Compound Name | N-[[5-[(1-benzylpiperidin-4-yl)sulfamoyl]thiophen-2-yl]methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 55355371 |
| Molecular Formula | C19H26ClN3O3S2 |
| Molecular Weight | 444.02 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | N-[[5-[(1-benzylpiperidin-4-yl)sulfamoyl]thiophen-2-yl]methyl]acetamide;hydrochloride |
| SMILES | CC(=O)NCc1ccc(S(=O)(=O)NC2CCN(Cc3ccccc3)CC2)s1.Cl |
| InChI | InChI=1S/C19H25N3O3S2.ClH/c1-15(23)20-13-18-7-8-19(26-18)27(24,25)21-17-9-11-22(12-10-17)14-16-5-3-2-4-6-16;/h2-8,17,21H,9-14H2,1H3,(H,20,23);1H |
| InChIKey | MNTVZAYKLXTIPN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.02 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |