C17H23N3O5S — CID 36995103
N-cyclooctyl-2-(2-oxo-6-sulfamoyl-1,3-benzoxazol-3-yl)acetamide (PubChem CID 36995103) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is N-cyclooctyl-2-(2-oxo-6-sulfamoyl-1,3-benzoxazol-3-yl)acetamide.
| Compound Name | N-cyclooctyl-2-(2-oxo-6-sulfamoyl-1,3-benzoxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 36995103 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | N-cyclooctyl-2-(2-oxo-6-sulfamoyl-1,3-benzoxazol-3-yl)acetamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)oc(=O)n2CC(=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C17H23N3O5S/c18-26(23,24)13-8-9-14-15(10-13)25-17(22)20(14)11-16(21)19-12-6-4-2-1-3-5-7-12/h8-10,12H,1-7,11H2,(H,19,21)(H2,18,23,24) |
| InChIKey | FHBWVCUIWHPHME-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 124.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |