C15H17N2O6S- — CID 3590656
2-[6-(cyclohexylsulfamoyl)-2-oxo-1,3-benzoxazol-3-yl]acetate (PubChem CID 3590656) has the molecular formula C15H17N2O6S- and a molecular weight of 353.38 g/mol. Its IUPAC name is 2-[6-(cyclohexylsulfamoyl)-2-oxo-1,3-benzoxazol-3-yl]acetate.
| Compound Name | 2-[6-(cyclohexylsulfamoyl)-2-oxo-1,3-benzoxazol-3-yl]acetate |
|---|---|
| PubChem CID | 3590656 |
| Molecular Formula | C15H17N2O6S- |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 2-[6-(cyclohexylsulfamoyl)-2-oxo-1,3-benzoxazol-3-yl]acetate |
| SMILES | O=C([O-])Cn1c(=O)oc2cc(S(=O)(=O)NC3CCCCC3)ccc21 |
| InChI | InChI=1S/C15H18N2O6S/c18-14(19)9-17-12-7-6-11(8-13(12)23-15(17)20)24(21,22)16-10-4-2-1-3-5-10/h6-8,10,16H,1-5,9H2,(H,18,19)/p-1 |
| InChIKey | UHOLJIFABIYJGP-UHFFFAOYSA-M |
| XLogP | -0.04 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |