C15H17N2O6S- — CID 3590658
2-[6-(2-methylpiperidin-1-yl)sulfonyl-2-oxo-1,3-benzoxazol-3-yl]acetate (PubChem CID 3590658) has the molecular formula C15H17N2O6S- and a molecular weight of 353.38 g/mol. Its IUPAC name is 2-[6-(2-methylpiperidin-1-yl)sulfonyl-2-oxo-1,3-benzoxazol-3-yl]acetate.
| Compound Name | 2-[6-(2-methylpiperidin-1-yl)sulfonyl-2-oxo-1,3-benzoxazol-3-yl]acetate |
|---|---|
| PubChem CID | 3590658 |
| Molecular Formula | C15H17N2O6S- |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 2-[6-(2-methylpiperidin-1-yl)sulfonyl-2-oxo-1,3-benzoxazol-3-yl]acetate |
| SMILES | CC1CCCCN1S(=O)(=O)c1ccc2c(c1)oc(=O)n2CC(=O)[O-] |
| InChI | InChI=1S/C15H18N2O6S/c1-10-4-2-3-7-17(10)24(21,22)11-5-6-12-13(8-11)23-15(20)16(12)9-14(18)19/h5-6,8,10H,2-4,7,9H2,1H3,(H,18,19)/p-1 |
| InChIKey | KVPJCUGKDHCHPC-UHFFFAOYSA-M |
| XLogP | -0.09 |
| TPSA | 112.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |