C17H17N3O5S — CID 110615646
2-[(3-ethyl-2-oxo-1,3-benzoxazol-6-yl)sulfonylamino]-N-methylbenzamide (PubChem CID 110615646) has the molecular formula C17H17N3O5S and a molecular weight of 375.41 g/mol. Its IUPAC name is 2-[(3-ethyl-2-oxo-1,3-benzoxazol-6-yl)sulfonylamino]-N-methylbenzamide.
| Compound Name | 2-[(3-ethyl-2-oxo-1,3-benzoxazol-6-yl)sulfonylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 110615646 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-[(3-ethyl-2-oxo-1,3-benzoxazol-6-yl)sulfonylamino]-N-methylbenzamide |
| SMILES | CCn1c(=O)oc2cc(S(=O)(=O)Nc3ccccc3C(=O)NC)ccc21 |
| InChI | InChI=1S/C17H17N3O5S/c1-3-20-14-9-8-11(10-15(14)25-17(20)22)26(23,24)19-13-7-5-4-6-12(13)16(21)18-2/h4-10,19H,3H2,1-2H3,(H,18,21) |
| InChIKey | PGCHFKOJOLDLRQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |