C19H21N3O5S2 — CID 100724442
2-[(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)sulfonylamino]-N-(2-methoxyethyl)benzamide (PubChem CID 100724442) has the molecular formula C19H21N3O5S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 2-[(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)sulfonylamino]-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-[(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)sulfonylamino]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 100724442 |
| Molecular Formula | C19H21N3O5S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 2-[(3-ethyl-2-oxo-1,3-benzothiazol-6-yl)sulfonylamino]-N-(2-methoxyethyl)benzamide |
| SMILES | CCn1c(=O)sc2cc(S(=O)(=O)Nc3ccccc3C(=O)NCCOC)ccc21 |
| InChI | InChI=1S/C19H21N3O5S2/c1-3-22-16-9-8-13(12-17(16)28-19(22)24)29(25,26)21-15-7-5-4-6-14(15)18(23)20-10-11-27-2/h4-9,12,21H,3,10-11H2,1-2H3,(H,20,23) |
| InChIKey | JPVDURAMGVJSLS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|